|
Iranite |
|
Yang H, Sano J L, Eichler C, Downs R T, Costin G |
|
Acta Crystallographica C63 (2007) i122-i124 |
|
Iranite, CuPb10(CrO4)6(SiO4)2(OH)2, isomorphous with hemihedrite |
|
Locality: Chapacase mine, Sierra Cerillos district, Tocopilla, Chile |
|
_database_code_amcsd 0010340 |
|
9.5416 11.3992 10.7465 120.472 92.470 55.531 P-1 |
|
atom x y z Uiso U(1,1) U(2,2) U(3,3) U(1,2) U(1,3) U(2,3) |
|
Cu 0 .5 0 .0073 .0094 .0051 .0061 -.0042 -.0025 .0030 |
|
Pb1 .25932 .10817 .26084 .01674 .01577 .01461 .01353 -.00899 -.00408 .00552 |
|
Pb2 .26267 .08803 .65782 .01224 .01004 .01029 .01122 -.00534 -.00213 .00470 |
|
Pb3 .92955 .24266 .02886 .01330 .01343 .01210 .01257 -.00789 -.00281 .00636 |
|
Pb4 .73129 .41520 .74861 .01951 .02207 .02192 .02042 -.01419 -.01093 .01546 |
|
Pb5 .31800 .45125 .53230 .01563 .01874 .02070 .01581 -.01476 -.01030 .01279 |
|
Cr1 .95691 .07568 .35431 .0129 .0137 .0133 .0116 -.0101 -.0042 .0054 |
|
Cr2 .56240 .17381 .15417 .0085 .0070 .0062 .0077 -.0024 -.0009 .0036 |
|
Cr3 .45357 .32313 .83512 .0094 .0085 .0096 .0107 -.0059 -.0035 .0061 |
|
Si .0238 .4530 .66184 .0016 .0025 .0026 .0022 -.0010 -.0011 .0018 |
|
O1 .7526 .2258 .4793 .0273 .021 .021 .023 -.014 .001 .003 |
|
O2 .1016 .0791 .4400 .0241 .029 .026 .027 -.022 -.022 .016 |
|
O3 .9960 .1191 .7373 .0179 .019 .017 .015 -.014 -.004 .005 |
|
O4 .9711 .1113 .2286 .0276 .030 .038 .037 -.025 -.017 .031 |
|
O5 .5094 .1359 .2693 .0157 .016 .016 .016 -.010 -.003 .010 |
|
O6 .4274 .2011 .0550 .0239 .021 .031 .019 -.016 -.012 .015 |
|
O7 .7703 .0099 .0328 .0166 .011 .013 .014 -.001 .002 .007 |
|
O8 .5351 .3564 .2680 .0193 .019 .017 .026 -.012 -.008 .014 |
|
O9 .6089 .2855 .9127 .0239 .018 .028 .027 -.013 -.016 .019 |
|
O10 .4636 .3961 .7413 .0255 .037 .033 .027 -.027 -.013 .022 |
|
O11 .2494 .4823 .9729 .0159 .014 .010 .014 -.005 .000 .004 |
|
O12 .4831 .1376 .7178 .0165 .012 .012 .020 -.008 -.006 .006 |
|
O13 .2111 .3011 .5135 .0129 .010 .011 .010 -.006 .001 .003 |
|
O14 .0385 .3927 .7755 .0104 .013 .008 .006 -.004 -.0009 .005 |
|
O15 .9898 .3729 .2577 .0148 .024 .012 .011 -.012 -.005 .007 |
|
O16 .8491 .4798 .6138 .0146 .016 .016 .017 -.009 -.010 .013 |
|
OH .1390 .2594 .9361 .0097 .012 .005 .007 -.004 -.0003 .0022 |
|
|
| Download AMC data (View Text File) Download CIF data (View Text File) Download diffraction data (View Text File) View JMOL 3-D Structure (permalink) |
  |
Multiple datasets can be concatenated into a single downloadable file by selecting the datasets and then clicking
Multiple datasets can be downloaded as individual files inside a ZIP archive by selecting the datasets and then clicking
Total number of retrieved datasets: