A | This mineral is Anthropogenic. |
G | This mineral is directly dated. |
B | This mineral is reported as having this age. |
Y | This mineral is using an age reported as an element mineralization period. |
O | This mineral is using an age calculated from all data at the locality. |
R | The age displayed for this mineral originates from a different, non-child locality. |
P | The age displayed for this mineral is the range of ages for this mineral at all of this locality's children. |
This mineral's age has not yet been recorded. |
Mineral name | Structural Groups | IMA Formula | Max Age (Ma) | Min Age (Ma) | # of Sublocalities containing mineral | LOCALITY IDs, not mindat ids | # of localities containing mineral |
---|---|---|---|---|---|---|---|
Albite (*) | Feldspar | Na(AlSi3O8) | 2 | 50195,50196 | 8803 | ||
Alluaudite (*) | Alluaudite | NaMnFe3+2(PO4)3 | 1 | 50195 | 94 | ||
Analcime (*) | Analcime | Na(AlSi2O6)·H2O | 1 | 50195 | 1627 | ||
Antimony (*) | Arsenic | Sb | 1820 | 1790 | 1 | 50198 | 363 |
Arsenopyrite (*) | Arsenopyrite | FeAsS | 1820 | 1790 | 2 | 50197,50198 | 9052 |
Aurostibite (*) | Pyrite | AuSb2 | 1820 | 1790 | 1 | 50198 | 73 |
Bertrandite (*) | Not in a structural group | Be4Si2O7(OH)2 | 1 | 50194 | 606 | ||
Beryl (*) | Beryl | Be3Al2Si6O18 | 3 | 50194,50195,50196 | 4286 | ||
Bismuth (*) | Arsenic | Bi | 1820 | 1790 | 2 | 50197,50198 | 1966 |
Breithauptite (*) | Nickeline | NiSb | 1820 | 1790 | 1 | 50198 | 175 |
Cassiterite (*) | Rutile | SnO2 | 2 | 50195,50196 | 5171 | ||
Chalcopyrite (*) | Chalcopyrite | CuFeS2 | 1820 | 1790 | 2 | 50197,50198 | 27198 |
Clinosafflorite (*) | Löllingite | CoAs2 | 1820 | 1790 | 1 | 50198 | 21 |
Cookeite (*) | Chlorite Clay | (Al,Li)3Al2(Si,Al)4O10(OH)8 | 1 | 50194 | 181 | ||
Cordierite (*) | Beryl | Mg2Al4Si5O18 | 1 | 50199 | 1008 | ||
Diopside (*) | Pyroxene | CaMgSi2O6 | 1 | 50199 | 4135 | ||
Elbaite (*) | Tourmaline | Na(Al1.5Li1.5)Al6(Si6O18)(BO3)3(OH)3(OH) | 1 | 50195 | 520 | ||
Fluorapatite (*) | Apatite | Ca5(PO4)3F | 1 | 50194 | 2740 | ||
Galena (*) | Rocksalt | PbS | 1820 | 1790 | 3 | 50197,50198,50199 | 24243 |
Geocronite (*) | Geocronite | Pb14Sb6S23 | 1820 | 1790 | 1 | 50198 | 133 |
Gold (*) | Copper | Au | 1820 | 1790 | 2 | 50197,50198 | 30554 |
Gudmundite (*) | Arsenopyrite | FeSbS | 1820 | 1790 | 1 | 50198 | 170 |
Hedleyite (*) | Tetradymite | Bi7Te3 | 1820 | 1790 | 1 | 50197 | 104 |
Hessite (*) | None | Ag2Te | 1820 | 1790 | 1 | 50197 | 804 |
Hydroxylherderite (*) | Gadolinite | CaBe(PO4)(OH) | 1 | 50194 | 119 | ||
Ilmenite (*) | Corundum | Fe2+Ti4+O3 | 1820 | 1790 | 2 | 50197,50198 | 5433 |
Jordanite (*) | Geocronite | Pb14As6S23 | 1820 | 1790 | 1 | 50198 | 105 |
Joséite-B (*) | Tetradymite | Bi4Te2S | 1820 | 1790 | 2 | 50197,50198 | 86 |
Laumontite (*) | Not in a structural group | CaAl2Si4O12·4H2O | 1 | 50195 | 1271 | ||
Löllingite (*) | Löllingite | FeAs2 | 1820 | 1790 | 1 | 50197 | 762 |
Magnetite (*) | Spinel | Fe2+Fe3+2O4 | 1820 | 1790 | 2 | 50197,50198 | 14899 |
Maldonite (*) | None | Au2Bi | 1820 | 1790 | 1 | 50198 | 88 |
Microcline (*) | Feldspar | K(AlSi3O8) | 1 | 50195 | 4924 | ||
Muscovite (*) | Mica Clay | KAl2(Si3Al)O10(OH)2 | 1 | 50195 | 17380 | ||
Petalite (*) | Not in a structural group | LiAlSi4O10 | 1 | 50195 | 124 | ||
Pollucite (*) | Analcime | Cs(Si2Al)O6·nH2O | 1 | 50195 | 140 | ||
Pyrite (*) | Pyrite | FeS2 | 1820 | 1790 | 3 | 50197,50198,50199 | 39462 |
Pyrrhotite (*) | Nickeline | Fe7S8 | 1820 | 1790 | 2 | 50197,50199 | 9056 |
Quartz (*) | Quartz | SiO2 | 3 | 50195,50196,50199 | 61156 | ||
Rubicline (*) | Feldspar | Rb(AlSi3O8) | 1 | 50195 | 6 | ||
Rutile (*) | Rutile | TiO2 | 1820 | 1790 | 2 | 50196,50197 | 5614 |
Safflorite (*) | Löllingite | CoAs2 | 1820 | 1790 | 1 | 50198 | 317 |
Samarskite-(Y) (*) | Columbite | YFe3+Nb2O8 | 1 | 50196 | 353 | ||
Scheelite (*) | Scheelite | Ca(WO4) | 1820 | 1790 | 2 | 50197,50198 | 4894 |
Schorl (*) | Tourmaline | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) | 1 | 50195 | 2705 | ||
Silver (*) | Copper | Ag | 1 | 50199 | 5186 | ||
Sphalerite (*) | Sphalerite | ZnS | 1820 | 1790 | 2 | 50197,50199 | 21482 |
Spodumene (*) | Pyroxene | LiAlSi2O6 | 2 | 50195,50196 | 688 | ||
Tetrahedrite-(Zn) (*) | Tetrahedrite | Cu6(Cu4Zn2)Sb4S13 | 1 | 50199 | 5317 | ||
Ullmannite (*) | Ullmannite | NiSbS | 1820 | 1790 | 1 | 50198 | 293 |
Willyamite (*) | Cobaltite | CoSbS | 1820 | 1790 | 1 | 50198 | 25 |
Excel ID | Max Age (Ma) | Min Age (Ma) | Age as listed in reference | Dating Method | Age Interpret | Prioritized? | Sample Source | Sample Num | Run Num | Age from other Locality | Dated Mineral | Minerals explicitely stated as having this age | Age applies to these Elements | MinDat Locality ID | Dated Locality (Max Age) | Location as listed in reference | Reference | Reference DOI | Reference ID | Age Notes | |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Kristen002406 | 1820 | 1790 | gold mineralization | Au | 250922 | Satulinmäki Prospect, Somero, Southwest Finland, Finland | Riukka and Satulinmaki Gold Prospects | Saalmann et al. (2009) | 10.1016/j.precamres.2009.06.005 | PR174_53 |
Sample | Source Locality | Reference URL |
---|---|---|
All locality data graciously provided by mindat.org
All age data...
Other copyright data...