Important Update News
The RRUFF Project has been migrated to RRUFF.net. Please update your bookmarks immediately, if you have not done so.
The data on this website is already three years out of date, and the entire website will be taken offline before the end of the year.
We are grateful to NASA for the funding of this effort.
| A | This mineral is Anthropogenic. |
| G | This mineral is directly dated. |
| B | This mineral is reported as having this age. |
| Y | This mineral is using an age reported as an element mineralization period. |
| O | This mineral is using an age calculated from all data at the locality. |
| R | The age displayed for this mineral originates from a different, non-child locality. |
| P | The age displayed for this mineral is the range of ages for this mineral at all of this locality's children. |
| This mineral's age has not yet been recorded. |
| Mineral name | Structural Groups | IMA Formula | Max Age (Ma) | Min Age (Ma) | # of Sublocalities containing mineral | LOCALITY IDs, not mindat ids | # of localities containing mineral |
|---|---|---|---|---|---|---|---|
| Actinolite (*) | Amphibole | Ca2(Mg4.5-2.5Fe2+0.5-2.5)Si8O22(OH)2 | 126 | 83.6 | 2 | 35322,35360 | 3419 |
| Aegirine (*) | Pyroxene | NaFe3+Si2O6 | 1 | 35354 | 1022 | ||
| Aenigmatite (*) | Sapphirine | Na4[Fe2+10Ti2]O4[Si12O36] | 1 | 35354 | 133 | ||
| Albite (*) | Feldspar | Na(AlSi3O8) | 2 | 35350,35354 | 8803 | ||
| Alforsite (*) | Apatite | Ba5(PO4)3Cl | 1 | 35340 | 5 | ||
| Analcime (*) | Analcime | Na(AlSi2O6)·H2O | 1 | 35354 | 1627 | ||
| Andradite (*) | Garnet | Ca3Fe3+2(SiO4)3 | 126 | 83.6 | 5 | 35325,35340,35344,35351,35360 | 1534 |
| Anglesite (*) | Baryte | Pb(SO4) | 541 | 83.6 | 2 | 35329,35360 | 2734 |
| Ankerite (*) | None | Ca(Fe2+,Mg)(CO3)2 | 393 | 359 | 2 | 35347,35348 | 3092 |
| Anorthite (*) | Feldspar | Ca(Al2Si2O8) | 1 | 35340 | 1036 | ||
| Antigorite (*) | Serpentine Clay | Mg3Si2O5(OH)4 | 1 | 35322 | 708 | ||
| Arfvedsonite (*) | Amphibole | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 | 1 | 35354 | 295 | ||
| Arsenopyrite (*) | Arsenopyrite | FeAsS | 541 | 359 | 9 | 35325,35329,35344,35345,35348,35350,35351,35354,35356 | 9052 |
| Astrophyllite (*) | Astrophyllite | K2NaFe2+7Ti2(Si4O12)2O2(OH)4F | 1 | 35354 | 161 | ||
| Augite (*) | Pyroxene | (Ca,Mg,Fe)2Si2O6 | 1 | 35354 | 2060 | ||
| Azurite (*) | Not in a structural group | Cu3(CO3)2(OH)2 | 1 | 35330 | 5509 | ||
| Baryte (*) | Baryte | Ba(SO4) | 393 | 359 | 3 | 35340,35347,35348 | 11547 |
| Barytocalcite (*) | None | BaCa(CO3)2 | 393 | 359 | 2 | 35347,35348 | 83 |
| Bavsiite (*) | None | Ba2V2O2[Si4O12] | 1 | 35340 | 1 | ||
| Benstonite (*) | None | Ba6Ca6Mg(CO3)13 | 393 | 359 | 2 | 35347,35348 | 17 |
| Beryl (*) | Beryl | Be3Al2Si6O18 | 6 | 35326,35344,35345,35351,35357,35358 | 4286 | ||
| Bismuth (*) | Arsenic | Bi | 3 | 35322,35325,35345 | 1966 | ||
| Bornite (*) | None | Cu5FeS4 | 1 | 35325 | 5516 | ||
| Bournonite (*) | Bournonite | CuPbSbS3 | 541 | 495 | 2 | 35329,35356 | 1089 |
| Calcite (*) | Calcite | Ca(CO3) | 126 | 83.6 | 8 | 35322,35325,35327,35344,35350,35351,35358,35360 | 27770 |
| Cancrinite (*) | Cancrinite | (Na,Ca, )8(Al6Si6)O24(CO3,SO4)2·2H2O | 1 | 35354 | 232 | ||
| Cassiterite (*) | Rutile | SnO2 | 5 | 35325,35330,35344,35350,35351 | 5171 | ||
| Celsian (*) | Feldspar | Ba(Al2Si2O8) | 393 | 359 | 3 | 35340,35347,35348 | 100 |
| Cerchiaraite-(Al) (*) | Cerchiaraite | Ba4Al4(Si4O12)O2(OH)4Cl2[Si2O3(OH)4] | 1 | 35340 | 4 | ||
| Cerchiaraite-(Fe) (*) | Cerchiaraite | Ba4Fe3+4(Si4O12)O2(OH)4Cl2[Si2O3(OH)4] | 2 | 35340,35341 | 6 | ||
| Cerussite (*) | Aragonite | Pb(CO3) | 126 | 83.6 | 1 | 35360 | 4979 |
| Chalcocite (*) | None | Cu2S | 1 | 35325 | 5707 | ||
| Chalcopyrite (*) | Chalcopyrite | CuFeS2 | 541 | 83.6 | 14 | 35321,35322,35329,35330,35337,35340,35344,35347,35348,35351,35353,35356,35358,35360 | 27198 |
| Chondrodite (*) | Humite | Mg5(SiO4)2F2 | 1 | 35354 | 285 | ||
| Chromite (*) | Spinel | Fe2+Cr2O4 | 2 | 35358,35361 | 3902 | ||
| Cubanite (*) | Cubanite Wurtzite | CuFe2S3 | 1 | 35322 | 802 | ||
| Cymrite (*) | None | Ba(Si,Al)4(O,OH)8·H2O | 393 | 359 | 1 | 35348 | 46 |
| Danalite (*) | Cancrinite-sodalite Sodalite | Be3Fe2+4(SiO4)3S | 2 | 35344,35351 | 58 | ||
| Danburite (*) | Danburite | CaB2Si2O8 | 1 | 35325 | 148 | ||
| Datolite (*) | Gadolinite | CaB(SiO4)(OH) | 1 | 35325 | 498 | ||
| Diopside (*) | Pyroxene | CaMgSi2O6 | 126 | 83.6 | 5 | 35325,35340,35341,35345,35360 | 4135 |
| Dolomite (*) | None | CaMg(CO3)2 | 393 | 359 | 1 | 35348 | 9895 |
| Dravite (*) | Tourmaline | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) | 1 | 35358 | 648 | ||
| Edingtonite (*) | Edingtonite | Ba(Si3Al2)O10·4H2O | 1 | 35340 | 26 | ||
| Epidote (*) | Epidote Clinozoisite | Ca2(Al2Fe3+)[Si2O7][SiO4]O(OH) | 4 | 35322,35344,35351,35354 | 8173 | ||
| Erlichmanite (*) | Pyrite | OsS2 | 1 | 35361 | 110 | ||
| Eudialyte (*) | Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 | 1 | 35354 | 182 | ||
| Ferberite (*) | Columbite | Fe2+(WO4) | 1 | 35358 | 551 | ||
| Ferrokinoshitalite (*) | None | BaFe2+3(Si2Al2)O10(OH)2 | 1 | 35340 | 4 | ||
| Fluorapatite (*) | Apatite | Ca5(PO4)3F | 444 | 433 | 2 | 35337,35354 | 2740 |
| Fluorite (*) | Fluorite | CaF2 | 393 | 83.6 | 11 | 35322,35325,35330,35344,35345,35347,35350,35351,35354,35357,35360 | 9617 |
| Franckeite (*) | Cylindrite | Pb21.7Sn9.3Fe4.0Sb8.1S56.9 | 1 | 35327 | 52 | ||
| Freibergite (*) | Tetrahedrite | Ag6[Cu4Fe2]Sb4S12 | 393 | 359 | 1 | 35347 | 663 |
| Fresnoite (*) | Melilite | Ba2TiO(Si2O7) | 1 | 35340 | 17 | ||
| Galena (*) | Rocksalt | PbS | 541 | 83.6 | 11 | 35327,35329,35330,35337,35345,35347,35348,35349,35354,35356,35360 | 24243 |
| Geocronite (*) | Geocronite | Pb14Sb6S23 | 1 | 35327 | 133 | ||
| Gillespite (*) | Gillespite | BaFe2+Si4O10 | 1 | 35340 | 9 | ||
| Goethite (*) | Diaspore | FeO(OH) | 541 | 495 | 1 | 35329 | 7437 |
| Grossular (*) | Garnet | Ca3Al2(SiO4)3 | 126 | 83.6 | 2 | 35345,35360 | 1544 |
| Gypsum (*) | Gypsum | Ca(SO4)·2H2O | 541 | 495 | 2 | 35329,35358 | 6890 |
| Hastingsite (*) | Amphibole | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 | 1 | 35354 | 209 | ||
| Hedenbergite (*) | Pyroxene | CaFe2+Si2O6 | 3 | 35340,35344,35351 | 741 | ||
| Hematite (*) | Corundum | Fe2O3 | 126 | 83.6 | 4 | 35350,35354,35358,35360 | 14640 |
| Hemimorphite (*) | Not in a structural group | Zn4(Si2O7)(OH)2·H2O | 444 | 83.6 | 2 | 35337,35360 | 1689 |
| Ilmenite (*) | Corundum | Fe2+Ti4+O3 | 1 | 35350 | 5433 | ||
| Iridium (*) | Copper | Ir | 1 | 35361 | 162 | ||
| Isoferroplatinum (*) | Auricupride Perovskite | Pt3Fe | 1 | 35361 | 128 | ||
| Itsiite (*) | Hyalotekite | Ba2Ca(BSi2O7)2 | 1 | 35341 | 1 | ||
| Jamesonite (*) | None | Pb4FeSb6S14 | 1 | 35356 | 784 | ||
| Jarosite (*) | Alunite | KFe3+3(SO4)2(OH)6 | 1 | 35358 | 2228 | ||
| Kaolinite (*) | Clay Kaolinite | Al2Si2O5(OH)4 | 393 | 359 | 2 | 35347,35348 | 5591 |
| Lapieite (*) | Lapieite | CuNiSbS3 | 1 | 35353 | 2 | ||
| Laurite (*) | Pyrite | RuS2 | 1 | 35361 | 226 | ||
| Låvenite (*) | Wöhlerite | (Na,Ca)4(Mn2+,Fe2+)2(Zr,Ti,Nb)2(Si2O7)2(O,F)4 | 1 | 35354 | 58 | ||
| Löllingite (*) | Löllingite | FeAs2 | 1 | 35325 | 762 | ||
| Magnesite (*) | Calcite | Mg(CO3) | 1 | 35353 | 1487 | ||
| Magnetite (*) | Spinel | Fe2+Fe3+2O4 | 541 | 83.6 | 6 | 35321,35329,35344,35351,35354,35360 | 14899 |
| Malachite (*) | Malachite | Cu2(CO3)(OH)2 | 3 | 35330,35356,35358 | 12537 | ||
| Malayaite (*) | Titanite | CaSnO(SiO4) | 3 | 35325,35344,35351 | 40 | ||
| Marcasite (*) | Marcasite | FeS2 | 541 | 359 | 6 | 35329,35344,35348,35351,35353,35356 | 5674 |
| Meierite (*) | None | Ba44Si66Al30O192Cl25(OH)33 | 1 | 35340 | 1 | ||
| Microcline (*) | Feldspar | K(AlSi3O8) | 4 | 35322,35326,35350,35354 | 4924 | ||
| Millerite (*) | Millerite | NiS | 444 | 433 | 2 | 35337,35353 | 1066 |
| Molybdenite (*) | Molybdenite | MoS2 | 444 | 433 | 4 | 35337,35345,35354,35358 | 5800 |
| Mosandrite-(Ce) (*) | None | (Ca3REE)[(H2O)2Ca0.5 0.5]Ti(Si2O7)2(OH)2(H2O)2 | 1 | 35354 | 45 | ||
| Muirite (*) | None | Ba10Ca2Mn2+TiSi10O30(OH,Cl,F)10 | 1 | 35340 | 3 | ||
| Muscovite (*) | Mica Clay | KAl2(Si3Al)O10(OH)2 | 393 | 359 | 4 | 35336,35347,35348,35350 | 17380 |
| Nepheline (*) | Tridymite | Na3K(Al4Si4O16) | 1 | 35354 | 884 | ||
| Nordenskiöldine (*) | None | CaSn(BO3)2 | 1 | 35325 | 16 | ||
| Norsethite (*) | None | BaMg(CO3)2 | 393 | 359 | 2 | 35347,35348 | 30 |
| Osmium (*) | None | Os | 1 | 35361 | 169 | ||
| Owyheeite (*) | Owyheeite | Ag3Pb10Sb11S28 | 1 | 35356 | 89 | ||
| Gersdorffite-Pa3 (*) | Pyrite | NiAsS | 444 | 433 | 2 | 35337,35353 | 767 |
| Pellyite (*) | None | Ba2CaFe2+2Si6O17 | 1 | 35340 | 5 | ||
| Phlogopite (*) | Mica Clay | KMg3(AlSi3O10)(OH)2 | 2 | 35354,35358 | 2273 | ||
| Polydymite (*) | Spinel | Ni2+Ni3+2S4 | 444 | 433 | 2 | 35337,35353 | 131 |
| Potassic-magnesio-hastingsite (*) | Amphibole | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 | 1 | 35353 | 5 | ||
| Pyrite (*) | Pyrite | FeS2 | 541 | 83.6 | 15 | 35327,35329,35337,35340,35341,35344,35345,35347,35348,35350,35351,35353,35356,35358,35360 | 39462 |
| Pyrrhotite (*) | Nickeline | Fe7S8 | 541 | 83.6 | 12 | 35321,35322,35329,35337,35340,35344,35347,35348,35351,35354,35356,35360 | 9056 |
| Quartz (*) | Quartz | SiO2 | 393 | 83.6 | 19 | 35322,35326,35327,35330,35336,35340,35341,35344,35345,35347,35348,35349,35350,35351,35353,35354,35356,35358,35360 | 61156 |
| Riebeckite (*) | Amphibole | Na2(Fe2+3Fe3+2)Si8O22(OH)2 | 1 | 35354 | 375 | ||
| Robinsonite (*) | None | Pb4Sb6S13 | 1 | 35356 | 39 | ||
| Rutile (*) | Rutile | TiO2 | 1 | 35350 | 5614 | ||
| Sanbornite (*) | None | BaSi2O5 | 1 | 35340 | 13 | ||
| Scheelite (*) | Scheelite | Ca(WO4) | 6 | 35321,35322,35325,35330,35345,35358 | 4894 | ||
| Schorl (*) | Tourmaline | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) | 2 | 35350,35358 | 2705 | ||
| Siderite (*) | Calcite | Fe(CO3) | 393 | 359 | 3 | 35336,35347,35348 | 6417 |
| Smithsonite (*) | Calcite | Zn(CO3) | 444 | 83.6 | 2 | 35337,35360 | 2473 |
| Sodalite (*) | Cancrinite-sodalite Sodalite | Na4(Si3Al3)O12Cl | 1 | 35354 | 444 | ||
| Sphalerite (*) | Sphalerite | ZnS | 541 | 83.6 | 16 | 35322,35327,35329,35330,35337,35340,35341,35344,35345,35347,35348,35349,35351,35354,35356,35360 | 21482 |
| Spinel (*) | Spinel | MgAl2O4 | 1 | 35353 | 1934 | ||
| Stannite (*) | Stannite Sphalerite | Cu2FeSnS4 | 1 | 35327 | 668 | ||
| Stibnite (*) | Stibnite | Sb2S3 | 1 | 35354 | 3418 | ||
| Suzukiite (*) | None | BaV4+Si2O7 | 1 | 35340 | 4 | ||
| Taramellite (*) | None | Ba4(Fe3+,Ti)4O2[B2Si8O27]Clx | 1 | 35340 | 8 | ||
| Tetrahedrite-(Zn) (*) | Tetrahedrite | Cu6(Cu4Zn2)Sb4S13 | 541 | 433 | 4 | 35329,35337,35353,35356 | 5317 |
| Thorite (*) | Zircon | Th(SiO4) | 1 | 35350 | 1006 | ||
| Tintinaite (*) | Kobellite | Pb10Cu2Sb16S35 | 1 | 35356 | 24 | ||
| Titanite (*) | Titanite | CaTi(SiO4)O | 2 | 35322,35354 | 4899 | ||
| Titantaramellite (*) | None | Ba4(Ti,Fe3+,Mg)4(O,OH)2[B2Si8O27]Clx | 1 | 35340 | 10 | ||
| Topaz (*) | Topaz | Al2SiO4F2 | 1 | 35350 | 1476 | ||
| Uvarovite (*) | Garnet | Ca3Cr2(SiO4)3 | 1 | 35340 | 212 | ||
| Variscite (*) | None | Al(PO4)·2H2O | 1 | 35343 | 301 | ||
| Walstromite (*) | Margarosanite | BaCa2Si3O9 | 1 | 35340 | 8 | ||
| Witherite (*) | Aragonite | Ba(CO3) | 393 | 359 | 4 | 35340,35341,35347,35348 | 251 |
| Wollastonite (*) | Wollastonite | CaSiO3 | 1 | 35325 | 1247 | ||
| Wurtzite (*) | Wurtzite | ZnS | 444 | 83.6 | 2 | 35337,35360 | 372 |
| Zircon (*) | Zircon | Zr(SiO4) | 3 | 35350,35354,35358 | 5251 |
| Excel ID | Max Age (Ma) | Min Age (Ma) | Age as listed in reference | Dating Method | Age Interpret | Prioritized? | Sample Source | Sample Num | Run Num | Age from other Locality | Dated Mineral | Minerals explicitely stated as having this age | Age applies to these Elements | MinDat Locality ID | Dated Locality (Max Age) | Location as listed in reference | Reference | Reference DOI | Reference ID | Age Notes | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| sedexmvt-00058 | 541 | 495 | Cambrian | host rock age | 248542 | Anvil Mine, Faro, Watson Lake Mining District, Yukon, Canada | Faro | Taylor et al. (2009) | USGSOFR2009_1297 | ||||||||||||
| sedznpb-00090 | 541 | 521 | Early Cambrian | 248542 | Anvil Mine, Faro, Watson Lake Mining District, Yukon, Canada | Faro | Singer et al. (2009) | USGSOFR2009-1252 | |||||||||||||
| vms-00380 | 390 | 390 | Devonian | S | 192120 | Ice Deposit, Finlayson Lake Camp, Watson Lake Mining District, Yukon, Canada | Ice | Moiser et al. (2009) | USGSOFR2009_1034 | ||||||||||||
| vms-00381 | 330 | 330 | Mississippian | S | 192118 | Kudz Ze Kayah Deposit, Finlayson Lake Camp, Watson Lake Mining District, Yukon, Canada | Kudz Ze Kayah | Moiser et al. (2009) | USGSOFR2009_1034 | ||||||||||||
| vms-00383 | 360 | 360 | Devonian-Mississippian | S | 192116 | Wolverine Deposit, Finlayson Lake Camp, Watson Lake Mining District, Yukon, Canada | Wolverine | Moiser et al. (2009) | USGSOFR2009_1034 | ||||||||||||
| sedexmvt-00064 | 444 | 433 | Early Silurian | host rock age | 41743 | Howard's Pass Deposit, Watson Lake Mining District, Yukon, Canada | Howards Pass | Taylor et al. (2009) | USGSOFR2009_1297 | ||||||||||||
| sedznpb-00096 | 444 | 433 | Early Silurian | 41743 | Howard's Pass Deposit, Watson Lake Mining District, Yukon, Canada | Howards Pass | Singer et al. (2009) | USGSOFR2009-1252 | |||||||||||||
| sedexmvt-00065 | 383 | 359 | Late Devonian | host rock age | 203637 | Jason Deposit, Macmillan Pass, Watson Lake Mining District, Yukon, Canada | Jason | Taylor et al. (2009) | USGSOFR2009_1297 | ||||||||||||
| sedznpb-00097 | 393 | 359 | Middle–Late Devonian | 203637 | Jason Deposit, Macmillan Pass, Watson Lake Mining District, Yukon, Canada | Jason | Singer et al. (2009) | USGSOFR2009-1252 | |||||||||||||
| sedexmvt-00082 | 383 | 359 | Late Devonian | host rock age | 194139 | Tom Deposit, Macmillan Pass, Watson Lake Mining District, Yukon, Canada | Tom | Taylor et al. (2009) | USGSOFR2009_1297 | ||||||||||||
| sedznpb-00134 | 393 | 359 | Middle–Late|Devonian | 194139 | Tom Deposit, Macmillan Pass, Watson Lake Mining District, Yukon, Canada | Tom | Singer et al. (2009) | USGSOFR2009-1252 | |||||||||||||
| sedznpb-00115 | 126 | 83.6 | mid-Cretaceous | 627 | Sa Dena Hes Mine, Watson Lake, Watson Lake Mining District, Yukon, Canada | Mt. Hundere | Singer et al. (2009) | USGSOFR2009-1252 |
| Sample | Source Locality | Reference URL |
|---|---|---|
| R060185 | MW Claim, Screw Creek, Cassiar Mts, Watson Lake Mining District, Yukon, Canada | https://rruff.info/R060185 |
| R061079 | MW Claim, Screw Creek, Cassiar Mts, Watson Lake Mining District, Yukon, Canada | https://rruff.info/R061079 |
| R150042 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R150042 |
| R160010 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R160010 |
| R170045 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R170045 |
| R120160 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R120160 |
| R150078 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R150078 |
| R150039 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R150039 |
| R160011 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R160011 |
| R150079 | Gun Claim (Gunn Claim), Wilson Lake, Itsi Mt., Watson Lake Mining District, Yukon, Canada | https://rruff.info/R150079 |
| R110163 | Tintina Silver Mines, Tintina, Watson Lake Mining District, Yukon, Canada | https://rruff.info/R110163 |
All locality data graciously provided by mindat.org
All age data...
Other copyright data...