|
|
Name: Julgoldite-(Fe3+) RRUFF ID: R070261 Ideal Chemistry: Ca2Fe3+Fe3+2(Si2O7)(SiO4)O(OH)·H2O Locality: Harstigen Mine, Pajsberg, Filipstad, Varmland, Sweden Source: Michael Scott S104182 [view label] Owner: RRUFF Description: Dark gray metallic massive associated with hematite, andradite and rhodonite Status: The identification of this mineral is not yet confirmed. |
Mineral Group: [ Pumpellyite (6) ] |
RAMAN SPECTRUM | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|
BROAD SCAN WITH SPECTRAL ARTIFACTS | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|
REFERENCES for Julgoldite-(Fe3+) | |
---|---|
American Mineralogist Crystal Structure Database Record: [view record] |
|
Fleischer M (1971) New mineral names, American Mineralogist, 56, 2156-2159 [view file] |
|
Moore P B (1971) Julgoldite, the Fe+2 - Fe+3 dominant pumpellyite, a new mineral from Långban, Sweden, Lithos, 4, 93-99 |
|
Allmann R, Donnay G (1973) The crystal structure of julgoldite, Mineralogical Magazine, 39, 271-281 [view file] |
|
Passaglia E, Gottardi G (1973) Crystal chemistry and nomenclature of pumpellyites and julgoldites, The Canadian Mineralogist, 12, 219-223 [view file] |
|
Artioli G, Geiger C A, Dapiaggi M (2003) The crystal chemistry of julgoldite-Fe3+ from Bombay, India, studied using synchrotron X-ray powder diffraction and 57Fe Mössbauer spectroscopy, American Mineralogist, 88, 1084-1090 [view file] |
|
|