Important Update News
The RRUFF Project has been migrated to RRUFF.net. Please update your bookmarks immediately, if you have not done so.
The data on this website is already three years out of date, and the entire website will be taken offline before the end of the year.
We are grateful to NASA for the funding of this effort.
| A | This mineral is Anthropogenic. |
| G | This mineral is directly dated. |
| B | This mineral is reported as having this age. |
| Y | This mineral is using an age reported as an element mineralization period. |
| O | This mineral is using an age calculated from all data at the locality. |
| R | The age displayed for this mineral originates from a different, non-child locality. |
| P | The age displayed for this mineral is the range of ages for this mineral at all of this locality's children. |
| This mineral's age has not yet been recorded. |
| Mineral name | Structural Groups | IMA Formula | Max Age (Ma) | Min Age (Ma) | # of Sublocalities containing mineral | LOCALITY IDs, not mindat ids | # of localities containing mineral |
|---|---|---|---|---|---|---|---|
| Abellaite (*) | Not in a structural group | NaPb2(CO3)2(OH) | 0 | 0 | 1 | 109855 | 2 |
| Actinolite (*) | Amphibole | Ca2(Mg4.5-2.5Fe2+0.5-2.5)Si8O22(OH)2 | 1 | 109859 | 3419 | ||
| Andersonite (*) | Not in a structural group | Na2Ca(UO2)(CO3)3·5-6H2O | 0 | 0 | 1 | 109855 | 47 |
| Ankerite (*) | None | Ca(Fe2+,Mg)(CO3)2 | 56 | 23 | 1 | 109855 | 3092 |
| Antlerite (*) | Not in a structural group | Cu2+3(SO4)(OH)4 | 252 | 246 | 1 | 109855 | 246 |
| Aragonite (*) | Aragonite | Ca(CO3) | 252 | 0 | 1 | 109855 | 3250 |
| Arsenuranylite (*) | Phosphuranylite | Ca(UO2)4(AsO4)2(OH)4·6H2O | 252 | 246 | 1 | 109855 | 7 |
| Autunite (*) | Autunite | Ca(UO2)2(PO4)2·10-12H2O | 252 | 246 | 1 | 109855 | 1272 |
| Axinite-(Fe) (*) | Axinite | Ca4Fe2+2Al4[B2Si8O30](OH)2 | 1 | 109859 | 260 | ||
| Azurite (*) | Not in a structural group | Cu3(CO3)2(OH)2 | 252 | 246 | 1 | 109855 | 5509 |
| Bayleyite (*) | None | Mg2(UO2)(CO3)3·18H2O | 252 | 246 | 1 | 109855 | 38 |
| Billietite (*) | None | Ba(UO2)6O4(OH)6·8H2O | 252 | 246 | 1 | 109855 | 38 |
| Bismuth (*) | Arsenic | Bi | 252 | 0 | 1 | 109855 | 1966 |
| Boltwoodite (*) | None | (K,Na)(UO2)(SiO3OH)·1.5H2O | 252 | 246 | 1 | 109855 | 67 |
| Bornite (*) | None | Cu5FeS4 | 252 | 246 | 1 | 109855 | 5516 |
| Brochantite (*) | Brochantite | Cu4(SO4)(OH)6 | 252 | 246 | 1 | 109855 | 1633 |
| Calcite (*) | Calcite | Ca(CO3) | 252 | 0 | 1 | 109855 | 27770 |
| Carnotite (*) | None | K2(UO2)2(VO4)2·3H2O | 252 | 246 | 1 | 109855 | 1184 |
| Čejkaite (*) | None | Na4(UO2)(CO3)3 | 0 | 0 | 1 | 109855 | 9 |
| Chalcocite (*) | None | Cu2S | 252 | 246 | 1 | 109855 | 5707 |
| Chalconatronite (*) | None | Na2Cu(CO3)2·3H2O | 252 | 246 | 1 | 109855 | 23 |
| Chalcopyrite (*) | Chalcopyrite | CuFeS2 | 252 | 246 | 2 | 109855,109859 | 27198 |
| Clausthalite (*) | Rocksalt | PbSe | 252 | 0 | 1 | 109855 | 281 |
| Coffinite (*) | Zircon | U(SiO4)·nH2O | 252 | 246 | 1 | 109855 | 566 |
| Compreignacite (*) | Compreignacite | K2(UO2)6O4(OH)6·7H2O | 252 | 246 | 1 | 109855 | 27 |
| Covellite (*) | Covellite | CuS | 252 | 246 | 1 | 109855 | 4165 |
| Cuprosklodowskite (*) | None | Cu(UO2)2(SiO3OH)2·6H2O | 252 | 246 | 1 | 109855 | 58 |
| Devilline (*) | Devilline | CaCu4(SO4)2(OH)6·3H2O | 252 | 246 | 1 | 109855 | 366 |
| Dolomite (*) | None | CaMg(CO3)2 | 252 | 0 | 1 | 109855 | 9895 |
| Enargite (*) | Enargite Wurtzite | Cu3AsS4 | 252 | 246 | 1 | 109855 | 910 |
| Epidote (*) | Epidote Clinozoisite | Ca2(Al2Fe3+)[Si2O7][SiO4]O(OH) | 1 | 109859 | 8173 | ||
| Erythrite (*) | Vivianite | Co3(AsO4)2·8H2O | 252 | 0 | 1 | 109855 | 814 |
| Geerite (*) | None | Cu8S5 | 252 | 246 | 1 | 109855 | 38 |
| Goethite (*) | Diaspore | FeO(OH) | 252 | 0 | 1 | 109855 | 7437 |
| Gordaite (*) | Ktenasite | NaZn4(SO4)(OH)6Cl·6H2O | 252 | 0 | 1 | 109855 | 17 |
| Gypsum (*) | Gypsum | Ca(SO4)·2H2O | 252 | 0 | 2 | 109855,109860 | 6890 |
| Heinrichite (*) | None | Ba(UO2)2(AsO4)2·10H2O | 252 | 246 | 1 | 109855 | 18 |
| Hematite (*) | Corundum | Fe2O3 | 252 | 0 | 2 | 109855,109859 | 14640 |
| Huemulite (*) | Pascoite | Na4MgV5+10O28·24H2O | 252 | 246 | 1 | 109855 | 16 |
| Ilmenite (*) | Corundum | Fe2+Ti4+O3 | 1 | 109859 | 5433 | ||
| Ktenasite (*) | Ktenasite Devilline | ZnCu4(SO4)2(OH)6·6H2O | 252 | 246 | 1 | 109855 | 75 |
| Lavendulan (*) | None | NaCaCu5(AsO4)4Cl·5H2O | 252 | 246 | 1 | 109855 | 149 |
| Lecoqite-(Y) (*) | Not in a structural group | Na3Y(CO3)3·6H2O | 252 | 0 | 1 | 109855 | 2 |
| Malachite (*) | Malachite | Cu2(CO3)(OH)2 | 252 | 246 | 1 | 109855 | 12537 |
| Metamunirite (*) | None | NaV5+O3 | 0 | 0 | 1 | 109855 | 14 |
| Microcline (*) | Feldspar | K(AlSi3O8) | 1 | 109859 | 4924 | ||
| Montroseite (*) | Diaspore | (V3+,Fe2+,V4+)O(OH) | 252 | 246 | 1 | 109855 | 136 |
| Muscovite (*) | Mica Clay | KAl2(Si3Al)O10(OH)2 | 1 | 109859 | 17380 | ||
| Natrouranospinite (*) | Natroautunite | Na2(UO2)2(AsO4)2·5H2O | 252 | 246 | 1 | 109855 | 13 |
| Natrozippeite (*) | Zippeite | Na5(UO2)8(SO4)4O5(OH)3·12H2O | 252 | 246 | 1 | 109855 | 41 |
| Naumannite (*) | Not in a structural group | Ag2Se | 252 | 0 | 1 | 109855 | 192 |
| Olivenite (*) | Andalusite | Cu2(AsO4)(OH) | 252 | 246 | 1 | 109855 | 492 |
| Gersdorffite-Pa3 (*) | Pyrite | NiAsS | 252 | 0 | 1 | 109855 | 767 |
| Prehnite (*) | Prehnite | Ca2Al(Si3Al)O10(OH)2 | 1 | 109859 | 1898 | ||
| Pyrite (*) | Pyrite | FeS2 | 252 | 0 | 2 | 109855,109859 | 39462 |
| Pyrolusite (*) | Rutile | MnO2 | 252 | 0 | 1 | 109855 | 3106 |
| Quartz (*) | Quartz | SiO2 | 56 | 23 | 2 | 109855,109859 | 61156 |
| Roscoelite (*) | Mica | KV3+2(Si3Al)O10(OH)2 | 252 | 246 | 1 | 109855 | 253 |
| Rutile (*) | Rutile | TiO2 | 252 | 0 | 1 | 109855 | 5614 |
| Sanrománite (*) | Burbankite | Na2CaPb3(CO3)5 | 252 | 0 | 1 | 109855 | 2 |
| Schröckingerite (*) | None | NaCa3(UO2)(SO4)(CO3)3F·10H2O | 0 | 0 | 1 | 109855 | 128 |
| Sengierite (*) | Sengierite | Cu2(UO2)2(VO4)2(OH)2·6H2O | 252 | 246 | 1 | 109855 | 11 |
| Siderite (*) | Calcite | Fe(CO3) | 252 | 0 | 1 | 109855 | 6417 |
| Siegenite (*) | Spinel | CoNi2S4 | 252 | 0 | 1 | 109855 | 249 |
| Spionkopite (*) | None | Cu39S28 | 252 | 246 | 1 | 109855 | 73 |
| Tennantite-(Fe) (*) | Tetrahedrite | Cu6(Cu4Fe2)As4S13 | 252 | 246 | 1 | 109855 | 1803 |
| Tenorite (*) | None | CuO | 252 | 246 | 1 | 109855 | 1101 |
| Tetrahedrite-(Zn) (*) | Tetrahedrite | Cu6(Cu4Zn2)Sb4S13 | 252 | 246 | 1 | 109855 | 5317 |
| Thénardite (*) | None | Na2(SO4) | 252 | 0 | 1 | 109855 | 299 |
| Titanite (*) | Titanite | CaTi(SiO4)O | 1 | 109859 | 4899 | ||
| Torbernite (*) | None | Cu(UO2)2(PO4)2·12H2O | 252 | 246 | 1 | 109855 | 1059 |
| Trögerite (*) | Natroautunite | (H3O)(UO2)(AsO4)·3H2O | 252 | 246 | 1 | 109855 | 22 |
| Tyuyamunite (*) | None | Ca(UO2)2(VO4)2·5-8H2O | 252 | 246 | 1 | 109855 | 628 |
| Uraninite (*) | Fluorite | UO2 | 252 | 246 | 1 | 109855 | 2718 |
| Uranophane-α (*) | None | Ca(UO2)2(SiO3OH)2·5H2O | 252 | 246 | 1 | 109855 | 890 |
| Vandendriesscheite (*) | None | Pb1.6(UO2)10O6(OH)11·11H2O | 252 | 246 | 1 | 109855 | 52 |
| Volborthite (*) | Volborthite | Cu3V2O7(OH)2·2H2O | 252 | 246 | 1 | 109855 | 155 |
| Wittichenite (*) | None | Cu3BiS3 | 252 | 246 | 1 | 109855 | 297 |
| Xenotime-(Y) (*) | Zircon | Y(PO4) | 252 | 0 | 1 | 109855 | 939 |
| Zeunerite (*) | Autunite | Cu(UO2)2(AsO4)2·12H2O | 252 | 246 | 1 | 109855 | 185 |
| Age ID | Locality Notes |
|---|---|
| Michelle_516 | Primary stratabound mineralization of the Eureka mine occurs within the Buntsandstein redbeds. |
| Michelle_524 | Secondary mineralization of the Eureka mine occurs in small veins, fractures and joints. |
| Michelle_525 | The third stage of mineralization of the Eureka mine is due to supergene processes. Natural pseudomorphic replacement of primary ores result in a wide variety of secondary minerals, especially uranium minerals. |
| Michelle_526 | Recent post-mining mineralization on tunnel walls of the Eureka mine are considered Anthropogenic. They occur as crusts, coatings and cryptocrystalline efflorescences. |
| Excel ID | Max Age (Ma) | Min Age (Ma) | Age as listed in reference | Dating Method | Age Interpret | Prioritized? | Sample Source | Sample Num | Run Num | Age from other Locality | Dated Mineral | Minerals explicitely stated as having this age | Age applies to these Elements | MinDat Locality ID | Dated Locality (Max Age) | Location as listed in reference | Reference | Reference DOI | Reference ID | Age Notes | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Michelle_516 | 252 | 246 | Buntsandstein | Stratigraphy | Age of primary ore mineralization | Cu, V, U | 53316 | Eureka Mine, Castell-estaó, La Torre De Cabdella (La Torre De Capdella), La Vall Fosca, El Pallars Jussà, Lleida (Lérida), Catalonia, Spain | Eureka mine | Ibáñez-Insa et al. (2017) | 10.1127/ejm/2017/0029-2630 | EJM29_915 | Stage 1 of 4. Primary ore mineralization. | ||||||||
| Michelle_524 | 56 | 23 | Eocene-Oligocene | Stratigraphy | Age of tectonic activities and vein mineralization | Ankerite, Quartz | 53316 | Eureka Mine, Castell-estaó, La Torre De Cabdella (La Torre De Capdella), La Vall Fosca, El Pallars Jussà, Lleida (Lérida), Catalonia, Spain | Eureka mine | Ibáñez-Insa et al. (2017) | 10.1127/ejm/2017/0029-2630 | EJM29_915 | Stage 2 of 4. Tectonic activities of the Pyrenean orogeny allowed the remobilization of chemical species. Small veins, faults and joints were mineralized with quartz, ankerite and some sulfur minerals. | ||||||||
| Michelle_525 | 23 | 0 | Oligocene-0 | Stratigraphy | Age of pseudomorphic replacement of primary ore | 53316 | Eureka Mine, Castell-estaó, La Torre De Cabdella (La Torre De Capdella), La Vall Fosca, El Pallars Jussà, Lleida (Lérida), Catalonia, Spain | Eureka mine | Ibáñez-Insa et al. (2017) | 10.1127/ejm/2017/0029-2630 | EJM29_915 | Stage 3 of 4. Supergene process resulting in natural pseudomorphic replacement of primary ores. This allowed extensive secondary oxidized minerals including sulfates, arsenates, phosphates, vanadates or selenates. Many of the oxidized minerals contain U. | |||||||||
| Michelle_526 | 0 | 0 | 0 | Stratigraphy | Age of anthropogenic mineralization | Andersonite, Cejkaite, Liebigite, Schrockingerite, Abellaite | 53316 | Eureka Mine, Castell-estaó, La Torre De Cabdella (La Torre De Capdella), La Vall Fosca, El Pallars Jussà, Lleida (Lérida), Catalonia, Spain | Eureka mine | Ibáñez-Insa et al. (2017) | 10.1127/ejm/2017/0029-2630 | EJM29_915 | Stage 4 of 4. Supergene process resulting in anthropogenic mineralization. Post mining, secondary mineralization occurring as encrustations, coatings and cryptocrystalline efflorescences. |
| Sample | Source Locality | Reference URL |
|---|---|---|
| R070624 | Eureka Mine, Castell-estaó, La Torre De Cabdella (La Torre De Capdella), La Vall Fosca, El Pallars Jussà, Lleida (Lérida), Catalonia, Spain | https://rruff.info/R070624 |
All locality data graciously provided by mindat.org
All age data...
Other copyright data...