A | This mineral is Anthropogenic. |
G | This mineral is directly dated. |
B | This mineral is reported as having this age. |
Y | This mineral is using an age reported as an element mineralization period. |
O | This mineral is using an age calculated from all data at the locality. |
R | The age displayed for this mineral originates from a different, non-child locality. |
P | The age displayed for this mineral is the range of ages for this mineral at all of this locality's children. |
This mineral's age has not yet been recorded. |
Mineral name | Structural Groups | IMA Formula | Max Age (Ma) | Min Age (Ma) | # of Sublocalities containing mineral | LOCALITY IDs, not mindat ids | # of localities containing mineral |
---|---|---|---|---|---|---|---|
Albite (*) | Feldspar | Na(AlSi3O8) | 201 | 0 | 0 | 8803 | |
Anatase (*) | Not in a structural group | TiO2 | 201 | 0 | 0 | 2162 | |
Aragonite (*) | Aragonite | Ca(CO3) | 201 | 0 | 0 | 3250 | |
Ardennite-(As) (*) | Ardennite | Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 | 65 | 2.6 | 0 | 34 | |
Arseniopleite (*) | Alluaudite | NaCaMnMn2(AsO4)3 | 65 | 2.6 | 0 | 7 | |
Arseniosiderite (*) | Arseniosiderite | Ca2Fe3+3O2(AsO4)3·3H2O | 65 | 2.6 | 0 | 194 | |
Arsenogoyazite (*) | Alunite | SrAl3(AsO4)(AsO3OH)(OH)6 | 65 | 2.6 | 0 | 21 | |
Bergslagite (*) | Gadolinite | CaBe(AsO4)(OH) | 65 | 2.6 | 0 | 9 | |
Berzeliite (*) | Garnet | (NaCa2)Mg2(AsO4)3 | 65 | 2.6 | 0 | 6 | |
Birnessite (*) | None | (Na,Ca,K)0.6(Mn4+,Mn3+)2O4·1.5H2O | 201 | 0 | 0 | 178 | |
Brandtite (*) | Roselite | Ca2Mn2+(AsO4)2·2H2O | 65 | 2.6 | 0 | 18 | |
Braunite (*) | Braunite | Mn2+Mn3+6O8(SiO4) | 201 | 0 | 0 | 483 | |
Cabalzarite (*) | Natrochalcite | CaMg2(AsO4)2·2H2O | 65 | 2.6 | 0 | 4 | |
Calcite (*) | Calcite | Ca(CO3) | 201 | 0 | 0 | 27770 | |
Caryopilite (*) | Clay Serpentine | Mn2+3Si2O5(OH)4 | 201 | 0 | 0 | 83 | |
Clinochlore (*) | Chlorite Clay | Mg5Al(AlSi3O10)(OH)8 | 201 | 0 | 0 | 1756 | |
Conichalcite (*) | Adelite | CaCu(AsO4)(OH) | 65 | 2.6 | 0 | 363 | |
Coralloite (*) | Arthurite | Mn2+Mn3+2(AsO4)2(OH)2·4H2O | 65 | 2.6 | 0 | 4 | |
Falottaite (*) | Not in a structural group Oxalate | MnC2O4·3H2O | 0 | 0 | 0 | 2 | |
Geigerite (*) | Lindackerite | Mn2+5(AsO4)2(AsO3OH)2·10H2O | 65 | 2.6 | 0 | 7 | |
Grischunite (*) | Wicksite | NaCa2Mn2+5Fe3+(AsO4)6·2H2O | 65 | 2.6 | 0 | 1 | |
Hematite (*) | Corundum | Fe2O3 | 201 | 0 | 0 | 14640 | |
Hollandite (*) | Coronadite | Ba(Mn4+6Mn3+2)O16 | 201 | 0 | 0 | 243 | |
Kemmlitzite (*) | Alunite | SrAl3(AsO4)(SO4)(OH)6 | 65 | 2.6 | 0 | 7 | |
Kutnohorite (*) | None | CaMn2+(CO3)2 | 201 | 0 | 0 | 234 | |
Lindbergite (*) | Humboldtine Oxalate | Mn(C2O4)·2H2O | 0 | 0 | 0 | 12 | |
Manganberzeliite (*) | Garnet | (NaCa2)Mn2+2(AsO4)3 | 65 | 2.6 | 0 | 24 | |
Muscovite (*) | Mica Clay | KAl2(Si3Al)O10(OH)2 | 201 | 0 | 0 | 17380 | |
Parsettensite (*) | Stilpnomelane Clay | (K,Na,Ca)7.5(Mn,Mg)49Si72O168(OH)50·nH2O | 201 | 0 | 0 | 43 | |
Piemontite (*) | Epidote | Ca2(Al2Mn3+)[Si2O7][SiO4]O(OH) | 201 | 0 | 0 | 260 | |
Quartz (*) | Quartz | SiO2 | 201 | 0 | 0 | 61156 | |
Rhodochrosite (*) | Calcite | Mn(CO3) | 201 | 0 | 0 | 1711 | |
Rhodonite (*) | Rhodonite | CaMn3Mn(Si5O15) | 201 | 0 | 0 | 969 | |
Sarkinite (*) | Wagnerite | Mn2+2(AsO4)(OH) | 65 | 2.6 | 0 | 30 | |
Spessartine (*) | Garnet | Mn2+3Al2(SiO4)3 | 201 | 0 | 0 | 1214 | |
Sursassite (*) | Ardennite | Mn2+2Al3(SiO4)(Si2O7)(OH)3 | 201 | 0 | 0 | 24 | |
Talmessite (*) | Fairfieldite | Ca2Mg(AsO4)2·2H2O | 65 | 2.6 | 0 | 46 | |
Tilasite (*) | Titanite | CaMg(AsO4)F | 65 | 2.6 | 0 | 34 | |
Tinzenite (*) | Axinite | Ca2Mn2+4Al4[B2Si8O30](OH)2 | 201 | 0 | 0 | 24 | |
Todorokite (*) | None | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12·3-4H2O | 201 | 0 | 0 | 433 | |
Tripuhyite (*) | Rutile | Fe3+Sb5+O4 | 201 | 0 | 0 | 66 | |
Vaniniite (*) | Not in a structural group | Ca2Mn2+3Mn3+2O2(AsO4)4·2H2O | 65 | 2.6 | 0 | 1 | |
Wallkilldellite (*) | None | Ca2Mn2+3(AsO4)2(OH)4·9H2O | 65 | 2.6 | 0 | 20 |
Age ID | Locality Notes |
---|---|
Michelle_820 | A small Mn-deposit was excavated at the Falotta mine during World War II. Falotta belongs to the numerous Mn-occurrences embedded in the radiolarites, which overlay the MORB-basalts of the Platta Nappe in the Swiss Alps |
Michelle_821 | A small Mn-deposit was excavated at the Falotta mine during World War II. Falotta belongs to the numerous Mn-occurrences embedded in the radiolarites, which overlay the MORB-basalts of the Platta Nappe in the Swiss Alps |
Michelle_822 | A small Mn-deposit was excavated at the Falotta mine during World War II. Falotta belongs to the numerous Mn-occurrences embedded in the radiolarites, which overlay the MORB-basalts of the Platta Nappe in the Swiss Alps |
Excel ID | Max Age (Ma) | Min Age (Ma) | Age as listed in reference | Dating Method | Age Interpret | Prioritized? | Sample Source | Sample Num | Run Num | Age from other Locality | Dated Mineral | Minerals explicitely stated as having this age | Age applies to these Elements | MinDat Locality ID | Dated Locality (Max Age) | Location as listed in reference | Reference | Reference DOI | Reference ID | Age Notes | |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Michelle_820 | 201 | 145 | Jurassic | Age of oceanic ridge volcanism | 3211 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | Falotta Deposit | Brugger et al. (2000) | 10.2138/am-2000-8-925 | AM85_1307 | A syn-sedimentary exhalative origin in connection with the Jurassic oceanic ridge volcanism is proposed for these deposits. | ||||||||||
Michelle_821 | 65 | 2.6 | Tertiary | Age of recrystallization | Cabalzarite | As | 3211 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | Falotta Deposit | Brugger et al. (2000) | 10.2138/am-2000-8-925 | AM85_1307 | The sedimentary ores recrystallized during the regional Alpine metamorphism under lowest greenschist facies conditions (≤325 °C, 3–5 kb). Together with other arsenates, cabalzarite documents the mobility of As during the retrograde stage of the Tertiary Alpine metamorphism under lowest to sub-greenschist facies conditions. | ||||||||
Michelle_822 | 0 | 0 | Recent | Age of oxalate mineralization | high | Lindbergite, Falottaite | 3211 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | Falotta Deposit | Graeser and Gabriel (2016) | SS3_20 | A natural occurrence of Mn oxalate trihydrate has been recorded from Falotta, Oberhalbstein, Grisons, Switzerland. The mineral occurs on small quartz crystals, associated with braunite and other Mn minerals. Presumably, the mineral formed by a reaction of humic acids with the primary Mn ore. Falottaite easily dehydrates to form Lindbergite. |
Sample | Source Locality | Reference URL |
---|---|---|
FKM-185 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | https://www.rockptx.com/fkm-176-to-fkm-200/#FKM-185 |
R060658 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | https://rruff.info/R060658 |
R130677 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | https://rruff.info/R130677 |
R070663 | Falotta, Tinizong (Tinzen), Oberhalbstein (Surses; Sursass), Albula Valley, Grisons, Switzerland | https://rruff.info/R070663 |
All locality data graciously provided by mindat.org
All age data...
Other copyright data...