Important Update News
The RRUFF Project has been migrated to RRUFF.net. Please update your bookmarks immediately, if you have not done so.
The data on this website is already three years out of date, and the entire website will be taken offline before the end of the year.
We are grateful to NASA for the funding of this effort.
| A | This mineral is Anthropogenic. |
| G | This mineral is directly dated. |
| B | This mineral is reported as having this age. |
| Y | This mineral is using an age reported as an element mineralization period. |
| O | This mineral is using an age calculated from all data at the locality. |
| R | The age displayed for this mineral originates from a different, non-child locality. |
| P | The age displayed for this mineral is the range of ages for this mineral at all of this locality's children. |
| This mineral's age has not yet been recorded. |
| Mineral name | Structural Groups | IMA Formula | Max Age (Ma) | Min Age (Ma) | # of Sublocalities containing mineral | LOCALITY IDs, not mindat ids | # of localities containing mineral |
|---|---|---|---|---|---|---|---|
| Actinolite (*) | Amphibole | Ca2(Mg4.5-2.5Fe2+0.5-2.5)Si8O22(OH)2 | 270 | 55 | 9 | 118779,118791,118792,118795,118797,118802,118803,118804,118805 | 3419 |
| Albite (*) | Feldspar | Na(AlSi3O8) | 399 | 45 | 1 | 118848 | 8803 |
| Allanite-(Ce) (*) | Allanite Epidote | CaCe(Al2Fe2+)[Si2O7][SiO4]O(OH) | 399 | 45 | 1 | 118848 | 706 |
| Allophane (*) | Allophane | Al2O3(SiO2)1.3-2.0·2.5-3.0H2O | 270 | 100 | 1 | 118784 | 470 |
| Almandine (*) | Garnet | Fe2+3Al2(SiO4)3 | 270 | 100 | 1 | 118790 | 2353 |
| Andersonite (*) | Not in a structural group | Na2Ca(UO2)(CO3)3·5-6H2O | 399 | 45 | 1 | 118848 | 47 |
| Andradite (*) | Garnet | Ca3Fe3+2(SiO4)3 | 61 | 55 | 1 | 118778 | 1534 |
| Anthophyllite (*) | Amphibole | Mg2Mg5Si8O22(OH)2 | 270 | 55 | 2 | 118778,118828 | 718 |
| Antimony (*) | Arsenic | Sb | 270 | 100 | 1 | 118779 | 363 |
| Antlerite (*) | Not in a structural group | Cu2+3(SO4)(OH)4 | 270 | 100 | 2 | 118784,118788 | 246 |
| Aragonite (*) | Aragonite | Ca(CO3) | 399 | 45 | 6 | 118779,118784,118800,118802,118848,118866 | 3250 |
| Arsenic (*) | Arsenic | As | 399 | 45 | 3 | 118779,118783,118848 | 379 |
| Arsenogoyazite (*) | Alunite | SrAl3(AsO4)(AsO3OH)(OH)6 | 270 | 100 | 1 | 118783 | 21 |
| Arsenopyrite (*) | Arsenopyrite | FeAsS | 270 | 55 | 7 | 118773,118779,118802,118833,118834,118866,118868 | 9052 |
| Asbolane (*) | Not in a structural group | Mn4+(O,OH)2·(Co,Ni,Mg,Ca)x(OH)2x·nH2O | 270 | 100 | 1 | 118792 | 143 |
| Atacamite (*) | Atacamite | Cu2Cl(OH)3 | 270 | 100 | 6 | 118779,118780,118783,118795,118850,118866 | 544 |
| Augite (*) | Pyroxene | (Ca,Mg,Fe)2Si2O6 | 270 | 100 | 2 | 118779,118783 | 2060 |
| Autunite (*) | Autunite | Ca(UO2)2(PO4)2·10-12H2O | 399 | 45 | 2 | 118800,118848 | 1272 |
| Axinite-(Fe) (*) | Axinite | Ca4Fe2+2Al4[B2Si8O30](OH)2 | 270 | 100 | 4 | 118779,118789,118792,118793 | 260 |
| Azurite (*) | Not in a structural group | Cu3(CO3)2(OH)2 | 270 | 100 | 3 | 118779,118783,118866 | 5509 |
| Baryte (*) | Baryte | Ba(SO4) | 270 | 100 | 2 | 118795,118799 | 11547 |
| Becquerelite (*) | None | Ca(UO2)6O4(OH)6·8H2O | 399 | 45 | 1 | 118848 | 92 |
| Beryl (*) | Beryl | Be3Al2Si6O18 | 270 | 100 | 2 | 118834,118857 | 4286 |
| Bismite (*) | None | Bi2O3 | 270 | 100 | 2 | 118783,118866 | 214 |
| Bismuth (*) | Arsenic | Bi | 399 | 45 | 6 | 118773,118779,118783,118802,118848,118866 | 1966 |
| Bismuthinite (*) | Stibnite | Bi2S3 | 270 | 55 | 7 | 118773,118779,118783,118800,118802,118843,118866 | 1935 |
| Bismutite (*) | Bismutite | Bi2O2(CO3) | 270 | 55 | 3 | 118800,118802,118866 | 716 |
| Boltwoodite (*) | None | (K,Na)(UO2)(SiO3OH)·1.5H2O | 270 | 100 | 1 | 118795 | 67 |
| Bornite (*) | None | Cu5FeS4 | 399 | 45 | 5 | 118779,118783,118833,118848,118866 | 5516 |
| Botallackite (*) | Atacamite | Cu2Cl(OH)3 | 270 | 100 | 7 | 118780,118783,118784,118789,118795,118797,118866 | 49 |
| Brochantite (*) | Brochantite | Cu4(SO4)(OH)6 | 399 | 45 | 6 | 118783,118784,118834,118848,118855,118866 | 1633 |
| Brushite (*) | Gypsum | Ca(PO3OH)·2H2O | 270 | 100 | 1 | 118783 | 104 |
| Buttgenbachite (*) | Connellite | Cu36(NO3)2Cl8(OH)62·nH2O | 270 | 100 | 1 | 118779 | 13 |
| Calcite (*) | Calcite | Ca(CO3) | 270 | 55 | 17 | 118773,118779,118783,118791,118792,118795,118797,118799,118800,118802,118816,118828,118834,118848,118849,118866,118869 | 27770 |
| Cassiterite (*) | Rutile | SnO2 | 270 | 55 | 52 | 118773,118775,118777,118779,118780,118781,118782,118783,118784,118792,118797,118799,118800,118801,118802,118804,118805,118807,118810,118812,118813,118814,118816,118818,118820,118821,118822,118825,118826,118827,118830,118831,118832,118833,118834,118837,118840,118841,118843,118847,118848,118851,118852,118854,118855,118859,118860,118866,118868,118869,118871,118872 | 5171 |
| Cerussite (*) | Aragonite | Pb(CO3) | 270 | 100 | 1 | 118795 | 4979 |
| Chalcanthite (*) | Chalcanthite | Cu(SO4)·5H2O | 399 | 45 | 3 | 118779,118802,118848 | 925 |
| Chalcocite (*) | None | Cu2S | 399 | 45 | 17 | 118779,118783,118784,118785,118795,118799,118800,118816,118832,118833,118834,118848,118859,118866,118867,118868,118869 | 5707 |
| Chalcomenite (*) | None | Cu(Se4+O3)·2H2O | 270 | 100 | 1 | 118785 | 40 |
| Chalcophyllite (*) | Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24·36H2O | 270 | 100 | 2 | 118784,118797 | 194 |
| Chalcopyrite (*) | Chalcopyrite | CuFeS2 | 270 | 100 | 18 | 118779,118783,118784,118785,118786,118795,118799,118800,118832,118833,118834,118840,118843,118848,118850,118855,118859,118866 | 27198 |
| Chamosite (*) | Chlorite Clay | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 | 399 | 45 | 1 | 118848 | 577 |
| Chlorargyrite (*) | Rocksalt | AgCl | 270 | 100 | 2 | 118779,118866 | 1382 |
| Chrysocolla (*) | Allophane | (Cu2-xAlx)H2-xSi2O5(OH)4·nH2O | 270 | 55 | 3 | 118784,118800,118802 | 3531 |
| Clinoatacamite (*) | Atacamite | Cu2Cl(OH)3 | 270 | 100 | 1 | 118866 | 43 |
| Clinoclase (*) | None | Cu3(AsO4)(OH)3 | 270 | 100 | 1 | 118784 | 127 |
| Clinoptilolite-Ca (*) | Heulandite | Ca3(Si30Al6)O72·20H2O | 270 | 100 | 1 | 118784 | 33 |
| Cobaltite (*) | Cobaltite | CoAsS | 270 | 100 | 2 | 118779,118783 | 966 |
| Coffinite (*) | Zircon | U(SiO4)·nH2O | 270 | 100 | 2 | 118848,118849 | 566 |
| Compreignacite (*) | Compreignacite | K2(UO2)6O4(OH)6·7H2O | 399 | 45 | 3 | 118800,118802,118848 | 27 |
| Connellite (*) | Connellite | Cu36(SO4)(OH)62Cl8·6H2O | 399 | 45 | 12 | 118779,118783,118784,118785,118795,118797,118800,118833,118834,118848,118855,118866 | 295 |
| Copper (*) | Copper | Cu | 399 | 45 | 15 | 118773,118779,118783,118785,118786,118795,118799,118800,118804,118833,118843,118848,118860,118866,118868 | 3846 |
| Cordierite (*) | Beryl | Mg2Al4Si5O18 | 270 | 100 | 2 | 118789,118828 | 1008 |
| Cornubite (*) | None | Cu5(AsO4)2(OH)4 | 270 | 100 | 2 | 118779,118783 | 109 |
| Cornwallite (*) | None | Cu5(AsO4)2(OH)4 | 270 | 100 | 2 | 118779,118783 | 175 |
| Corundum (*) | Corundum | Al2O3 | 270 | 100 | 1 | 118828 | 1797 |
| Covellite (*) | Covellite | CuS | 399 | 45 | 1 | 118848 | 4165 |
| Cumengeite (*) | None | Pb21Cu20Cl42(OH)40·6H2O | 270 | 100 | 1 | 118795 | 43 |
| Cummingtonite (*) | Amphibole | Mg2Mg5Si8O22(OH)2 | 270 | 100 | 2 | 118787,118828 | 327 |
| Cuprite (*) | Not in a structural group | Cu2O | 399 | 45 | 8 | 118779,118784,118785,118795,118800,118848,118866,118868 | 2970 |
| Cuprosklodowskite (*) | None | Cu(UO2)2(SiO3OH)2·6H2O | 399 | 45 | 3 | 118779,118797,118848 | 58 |
| Cyanotrichite (*) | Cyanotrichite | Cu4Al2(SO4)(OH)12(H2O)2 | 270 | 100 | 1 | 118784 | 179 |
| Danalite (*) | Cancrinite-sodalite Sodalite | Be3Fe2+4(SiO4)3S | 270 | 100 | 1 | 118789 | 58 |
| Devilline (*) | Devilline | CaCu4(SO4)2(OH)6·3H2O | 399 | 45 | 3 | 118784,118848,118855 | 366 |
| Dewindtite (*) | Phosphuranylite | H2Pb3(UO2)6O4(PO4)4·12H2O | 270 | 100 | 1 | 118795 | 82 |
| Diaspore (*) | Diaspore | AlO(OH) | 270 | 100 | 1 | 118828 | 481 |
| Digenite (*) | Digenite | Cu1.8S | 270 | 100 | 2 | 118779,118785 | 1027 |
| Diopside (*) | Pyroxene | CaMgSi2O6 | 270 | 55 | 2 | 118791,118802 | 4135 |
| Djurleite (*) | None | Cu31S16 | 399 | 45 | 2 | 118802,118848 | 300 |
| Dolomite (*) | None | CaMg(CO3)2 | 399 | 45 | 9 | 118779,118795,118797,118802,118804,118828,118834,118848,118866 | 9895 |
| Dravite (*) | Tourmaline | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) | 270 | 100 | 2 | 118781,118800 | 648 |
| Epidote (*) | Epidote Clinozoisite | Ca2(Al2Fe3+)[Si2O7][SiO4]O(OH) | 270 | 100 | 4 | 118779,118783,118789,118791 | 8173 |
| Erythrite (*) | Vivianite | Co3(AsO4)2·8H2O | 270 | 100 | 4 | 118779,118791,118792,118800 | 814 |
| Ferro-hornblende (*) | Amphibole | Ca2(Fe2+4Al)(Si7Al)O22(OH)2 | 61 | 55 | 1 | 118778 | 271 |
| Feruvite (*) | Tourmaline | CaFe2+3(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) | 270 | 100 | 1 | 118781 | 15 |
| Fluorapatite (*) | Apatite | Ca5(PO4)3F | 399 | 45 | 10 | 118779,118783,118799,118800,118832,118834,118843,118848,118855,118866 | 2740 |
| Fluorite (*) | Fluorite | CaF2 | 399 | 45 | 11 | 118773,118779,118783,118799,118800,118816,118818,118848,118866,118868,118869 | 9617 |
| Galena (*) | Rocksalt | PbS | 270 | 100 | 2 | 118779,118828 | 24243 |
| Goethite (*) | Diaspore | FeO(OH) | 399 | 45 | 20 | 118779,118782,118783,118784,118785,118786,118797,118799,118800,118801,118802,118816,118824,118833,118834,118837,118843,118848,118860,118866 | 7437 |
| Gold (*) | Copper | Au | 61 | 55 | 1 | 118778 | 30554 |
| Goslarite (*) | Epsomite | Zn(SO4)·7H2O | 270 | 100 | 2 | 118779,118828 | 188 |
| Graphite (*) | None | C | 61 | 55 | 1 | 118778 | 2812 |
| Grossular (*) | Garnet | Ca3Al2(SiO4)3 | 270 | 100 | 2 | 118791,118794 | 1544 |
| Grunerite (*) | Amphibole | Fe2+2Fe2+5Si8O22(OH)2 | 61 | 55 | 1 | 118778 | 223 |
| Gypsum (*) | Gypsum | Ca(SO4)·2H2O | 270 | 100 | 3 | 118848,118850,118866 | 6890 |
| Hastingsite (*) | Amphibole | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 | 270 | 100 | 1 | 118783 | 209 |
| Helvine (*) | Sodalite Cancrinite-sodalite | Be3Mn2+4(SiO4)3S | 270 | 100 | 1 | 118866 | 237 |
| Hematite (*) | Corundum | Fe2O3 | 270 | 55 | 24 | 118773,118779,118780,118782,118783,118785,118786,118797,118799,118802,118816,118831,118833,118834,118843,118848,118849,118851,118853,118855,118860,118865,118866,118868 | 14640 |
| Heulandite-Ca (*) | Heulandite | (Ca,Na,K)5(Si27Al9)O72·26H2O | 270 | 100 | 1 | 118784 | 246 |
| Heulandite-K (*) | Heulandite | (K,Ca,Na)5(Si27Al9)O72·26H2O | 270 | 100 | 1 | 118784 | 32 |
| Nováčekite-I (*) | None | Mg(UO2)2(AsO4)2·12H2O | 61 | 55 | 1 | 118802 | 55 |
| Jarosite (*) | Alunite | KFe3+3(SO4)2(OH)6 | 270 | 100 | 3 | 118783,118784,118788 | 2228 |
| Johannite (*) | Johannite | Cu(UO2)2(SO4)2(OH)2·8H2O | 399 | 45 | 1 | 118848 | 69 |
| Kaolinite (*) | Clay Kaolinite | Al2Si2O5(OH)4 | 399 | 45 | 5 | 118773,118782,118843,118848,118863 | 5591 |
| Kasolite (*) | None | Pb(UO2)(SiO4)·H2O | 270 | 100 | 2 | 118779,118795 | 198 |
| Kröhnkite (*) | Roselite | Na2Cu(SO4)2·2H2O | 270 | 100 | 1 | 118784 | 27 |
| Langite (*) | None | Cu4(SO4)(OH)6·2H2O | 399 | 45 | 7 | 118779,118784,118800,118833,118834,118848,118866 | 593 |
| Laumontite (*) | Not in a structural group | CaAl2Si4O12·4H2O | 399 | 45 | 1 | 118848 | 1271 |
| Lavendulan (*) | None | NaCaCu5(AsO4)4Cl·5H2O | 270 | 55 | 2 | 118795,118802 | 149 |
| Lepidocrocite (*) | Lepidocrocite | Fe3+O(OH) | 270 | 100 | 1 | 118833 | 581 |
| Libethenite (*) | Andalusite | Cu2(PO4)(OH) | 270 | 100 | 2 | 118783,118797 | 234 |
| Magnetite (*) | Spinel | Fe2+Fe3+2O4 | 270 | 100 | 3 | 118779,118783,118791 | 14899 |
| Malachite (*) | Malachite | Cu2(CO3)(OH)2 | 399 | 45 | 13 | 118779,118783,118784,118785,118795,118799,118800,118802,118833,118834,118848,118855,118866 | 12537 |
| Malayaite (*) | Titanite | CaSnO(SiO4) | 270 | 100 | 1 | 118791 | 40 |
| Manganite (*) | Rutile | Mn3+O(OH) | 270 | 100 | 3 | 118779,118783,118799 | 770 |
| Marcasite (*) | Marcasite | FeS2 | 399 | 45 | 1 | 118848 | 5674 |
| Melanterite (*) | Melanterite | Fe(SO4)·7H2O | 399 | 45 | 1 | 118848 | 915 |
| Mesolite (*) | Natrolite | Na2Ca2(Si9Al6)O30·8H2O | 270 | 100 | 1 | 118779 | 425 |
| Metanováčekite (*) | None | Mg(UO2)2(AsO4)2·8H2O | 270 | 100 | 1 | 118797 | 26 |
| Metasaléeite (*) | None | Mg(UO2)2(PO4)2·8H2O | 270 | 100 | 1 | 118800 | 11 |
| Metatorbernite (*) | None | Cu(UO2)2(PO4)2·8H2O | 270 | 100 | 2 | 118797,118800 | 443 |
| Metavoltine (*) | Metavoltine | K2Na6Fe2+Fe3+6O2(SO4)12·18H2O | 270 | 100 | 1 | 118800 | 78 |
| Metazeunerite (*) | None | Cu(UO2)2(AsO4)2·8H2O | 399 | 45 | 3 | 118797,118800,118848 | 182 |
| Mixite (*) | Mixite | Cu6Bi(AsO4)3(OH)6·3H2O | 270 | 100 | 1 | 118800 | 168 |
| Montmorillonite (*) | Clay Smectite-vermiculite | (Na,Ca)0.3(Al,Mg)2Si4O10(OH)2·nH2O | 399 | 45 | 1 | 118848 | 1508 |
| Muscovite (*) | Mica Clay | KAl2(Si3Al)O10(OH)2 | 270 | 100 | 1 | 118773 | 17380 |
| Nantokite (*) | Sphalerite | CuCl | 270 | 100 | 1 | 118866 | 35 |
| Natrolite (*) | Natrolite | Na2(Si3Al2)O10·2H2O | 270 | 100 | 2 | 118779,118789 | 1236 |
| Natron (*) | None | Na2(CO3)·10H2O | 61 | 55 | 1 | 118778 | 51 |
| Natrozippeite (*) | Zippeite | Na5(UO2)8(SO4)4O5(OH)3·12H2O | 270 | 100 | 2 | 118848,118850 | 41 |
| Neotocite (*) | Allophane | (Mn,Fe)SiO3·H2O (?) | 399 | 45 | 2 | 118802,118848 | 186 |
| Opal (*) | Amorphous | SiO2·nH2O | 270 | 100 | 5 | 118779,118781,118843,118852,118868 | 2994 |
| Orthoclase (*) | Feldspar | K(AlSi3O8) | 270 | 100 | 3 | 118773,118779,118830 | 2349 |
| Paratacamite (*) | Atacamite | Cu3(Cu,Zn)Cl2(OH)6 | 399 | 45 | 7 | 118779,118783,118784,118788,118797,118848,118866 | 158 |
| Pargasite (*) | Amphibole | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 | 270 | 100 | 1 | 118783 | 313 |
| Pharmacosiderite (*) | Pharmacosiderite | KFe3+4(AsO4)3(OH)4·6-7H2O | 270 | 55 | 3 | 118779,118802,118866 | 428 |
| Phenakite (*) | Phenakite | Be2(SiO4) | 270 | 100 | 2 | 118792,118800 | 326 |
| Pitticite (*) | None | [Fe,AsO4,SO4,H2O] (?) | 270 | 100 | 1 | 118779 | 140 |
| Prehnite (*) | Prehnite | Ca2Al(Si3Al)O10(OH)2 | 270 | 100 | 2 | 118789,118866 | 1898 |
| Pseudomalachite (*) | None | Cu5(PO4)2(OH)4 | 270 | 55 | 2 | 118779,118802 | 369 |
| Pyrite (*) | Pyrite | FeS2 | 399 | 45 | 16 | 118779,118783,118784,118785,118786,118795,118802,118805,118834,118840,118843,118848,118855,118860,118866,118868 | 39462 |
| Pyrolusite (*) | Rutile | MnO2 | 270 | 100 | 1 | 118784 | 3106 |
| Pyrrhotite (*) | Nickeline | Fe7S8 | 270 | 100 | 3 | 118779,118791,118866 | 9056 |
| Quartz (*) | Quartz | SiO2 | 283 | 55 | 45 | 118773,118777,118779,118781,118782,118783,118784,118785,118786,118789,118792,118797,118799,118800,118801,118802,118804,118809,118810,118812,118814,118816,118824,118831,118833,118834,118835,118837,118840,118843,118848,118849,118850,118852,118853,118854,118855,118860,118863,118864,118866,118868,118869,118870,118872 | 61156 |
| Rhodochrosite (*) | Calcite | Mn(CO3) | 399 | 45 | 7 | 118779,118783,118785,118799,118802,118848,118866 | 1711 |
| Roquesite (*) | Chalcopyrite | CuInS2 | 399 | 45 | 1 | 118848 | 46 |
| Rutherfordine (*) | None | (UO2)(CO3) | 270 | 100 | 1 | 118795 | 58 |
| Saléeite (*) | None | Mg(UO2)2(PO4)2(H2O)10 | 270 | 100 | 1 | 118800 | 95 |
| Scheelite (*) | Scheelite | Ca(WO4) | 270 | 100 | 3 | 118781,118792,118866 | 4894 |
| Schorl (*) | Tourmaline | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) | 283 | 100 | 20 | 118773,118779,118781,118782,118783,118785,118791,118792,118800,118803,118804,118816,118840,118843,118855,118860,118863,118866,118868,118872 | 2705 |
| Schröckingerite (*) | None | NaCa3(UO2)(SO4)(CO3)3F·10H2O | 399 | 45 | 1 | 118848 | 128 |
| Siderite (*) | Calcite | Fe(CO3) | 399 | 45 | 14 | 118779,118783,118785,118786,118797,118799,118800,118802,118816,118824,118833,118834,118848,118855 | 6417 |
| Silver (*) | Copper | Ag | 270 | 100 | 3 | 118779,118783,118866 | 5186 |
| Skutterudite (*) | Skutterudite Perovskite | CoAs3 | 270 | 100 | 2 | 118779,118791 | 531 |
| Sphalerite (*) | Sphalerite | ZnS | 399 | 45 | 6 | 118779,118785,118828,118847,118848,118866 | 21482 |
| Spinel (*) | Spinel | MgAl2O4 | 270 | 100 | 1 | 118828 | 1934 |
| Stannite (*) | Stannite Sphalerite | Cu2FeSnS4 | 270 | 100 | 2 | 118779,118784 | 668 |
| Stibnite (*) | Stibnite | Sb2S3 | 270 | 100 | 1 | 118783 | 3418 |
| Stokesite (*) | None | CaSnSi3O9·2H2O | 270 | 100 | 2 | 118792,118793 | 21 |
| Talc (*) | Clay Talc | Mg3Si4O10(OH)2 | 270 | 100 | 4 | 118779,118780,118783,118856 | 3337 |
| Tennantite-(Fe) (*) | Tetrahedrite | Cu6(Cu4Fe2)As4S13 | 399 | 45 | 4 | 118779,118848,118866,118868 | 1803 |
| Tenorite (*) | None | CuO | 270 | 100 | 5 | 118779,118800,118859,118868,118869 | 1101 |
| Tetrahedrite-(Zn) (*) | Tetrahedrite | Cu6(Cu4Zn2)Sb4S13 | 270 | 100 | 2 | 118779,118866 | 5317 |
| Titanite (*) | Titanite | CaTi(SiO4)O | 270 | 100 | 2 | 118781,118791 | 4899 |
| Topaz (*) | Topaz | Al2SiO4F2 | 270 | 100 | 1 | 118832 | 1476 |
| Torbernite (*) | None | Cu(UO2)2(PO4)2·12H2O | 270 | 55 | 4 | 118795,118797,118800,118802 | 1059 |
| Tremolite (*) | Amphibole | Ca2(Mg5.0-4.5Fe2+0.0-0.5)Si8O22(OH)2 | 270 | 100 | 1 | 118788 | 2562 |
| Triploidite (*) | Wagnerite | Mn2+2(PO4)(OH) | 61 | 55 | 1 | 118802 | 29 |
| Trögerite (*) | Natroautunite | (H3O)(UO2)(AsO4)·3H2O | 270 | 100 | 1 | 118795 | 22 |
| Tyuyamunite (*) | None | Ca(UO2)2(VO4)2·5-8H2O | 270 | 100 | 1 | 118797 | 628 |
| Uraninite (*) | Fluorite | UO2 | 270 | 55 | 6 | 118779,118795,118800,118802,118848,118849 | 2718 |
| Uranophane-α (*) | None | Ca(UO2)2(SiO3OH)2·5H2O | 270 | 100 | 2 | 118797,118800 | 890 |
| Uranopilite (*) | None | (UO2)6(SO4)O2(OH)6·14H2O | 399 | 45 | 3 | 118800,118802,118848 | 94 |
| Vandenbrandeite (*) | None | Cu(UO2)(OH)4 | 270 | 100 | 1 | 118800 | 9 |
| Vandendriesscheite (*) | None | Pb1.6(UO2)10O6(OH)11·11H2O | 270 | 100 | 1 | 118795 | 52 |
| Vesuvianite (*) | Vesuvianite | (Ca,Na)19(Al,Mg,Fe)13(SiO4)10(Si2O7)4(OH,F,O)10 | 61 | 55 | 1 | 118778 | 1395 |
| Vivianite (*) | Vivianite | Fe2+3(PO4)2·8H2O | 270 | 55 | 5 | 118779,118782,118799,118800,118802 | 636 |
| Volborthite (*) | Volborthite | Cu3V2O7(OH)2·2H2O | 270 | 100 | 1 | 118800 | 155 |
| Waylandite (*) | Alunite | BiAl3(PO4)2(OH)6 | 61 | 55 | 1 | 118802 | 31 |
| Wickmanite (*) | Perovskite | Mn2+Sn4+(OH)6 | 270 | 100 | 1 | 118793 | 24 |
| Widenmannite (*) | None | Pb2(OH)2[(UO2)(CO3)2] | 270 | 100 | 1 | 118795 | 9 |
| Wittichenite (*) | None | Cu3BiS3 | 399 | 45 | 2 | 118848,118866 | 297 |
| Wölsendorfite (*) | Wölsendorfite | Pb7(UO2)14O19(OH)4·12H2O | 270 | 100 | 1 | 118795 | 43 |
| Woodwardite (*) | Woodwardite Hydrotalcite | (Cu1-xAlx)(SO4)x/2(OH)2·nH2O (x < 0.5, n < 3x/2) | 270 | 100 | 2 | 118783,118784 | 57 |
| Zeunerite (*) | Autunite | Cu(UO2)2(AsO4)2·12H2O | 270 | 100 | 3 | 118795,118797,118800 | 185 |
| Zippeite (*) | Zippeite | K2[(UO2)4(SO4)2O2(OH)2](H2O)4 | 270 | 55 | 2 | 118800,118802 | 175 |
| Age ID | Locality Notes |
|---|---|
| Lucy_017 | Age of granite |
| Excel ID | Max Age (Ma) | Min Age (Ma) | Age as listed in reference | Dating Method | Age Interpret | Prioritized? | Sample Source | Sample Num | Run Num | Age from other Locality | Dated Mineral | Minerals explicitely stated as having this age | Age applies to these Elements | MinDat Locality ID | Dated Locality (Max Age) | Location as listed in reference | Reference | Reference DOI | Reference ID | Age Notes | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Lucy_081 | 270 | 100 | 270-100 | 40Ar - 39Ar | Lodes post-dating elvan intrusion and primary mineralization. | 1265 | St Just, Cornwall, England, UK | St Just | Hawkes et al. (1978 | US4_51 | Possibility of hydrothermal degassing of lode material around 210 Ma and 215 Ma which overprints a primary formation age of roughly 270 Ma. New mineral growth may have occurred close to 165 Ma with further hydrothermal activity at about 100 Ma. Adularia from veins in the Lizard Complex also provides indication | ||||||||||
| Lucy_255 | 61 | 55 | 58 ± 3 | 206Pb/238U | Using Pockleys Interpretations, it is acceptable to say that South Terras, Geevor, and Wheal Owles are not reliable indications of Tertiary mineralization. | 1309 | Wheal Owles, Botallack, St Just, Cornwall, England, UK | Wheal Owles | Darnley et al. (1965) | MM34_159 | Late infilling | ||||||||||
| Lucy_074 | 232 | 230 | 231 ± 1 | K-Ar | k-feldspar | 18534 | Pendeen, St Just, Cornwall, England, UK | St. Just-Pendeen | Halliday (1980) | 10.2113/gsecongeo.75.5.752 | EG75_752 | ||||||||||
| Lucy_017 | 270 | 266 | 268 ± 2 | 87Sr/86Sr ratio, Rb-Sr. | Age granite intruded | E 47623 | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Tin Mine | Darbyshire et al. (1985) | 10.1144/gsjgs.142.6.1159 | JGSL142_1159 | |||||||||
| Lucy_055 | 285 | 255 | 270 ± 15 | Rb-Sr | Main stage polymetallic mineralization, preferred age determined in study | whole rock | G 1, G 3, G 5, G 6, G 7, G 8 | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darbyshire et al. (1985) | 10.1144/gsjgs.142.6.1159 | JGSL142_1159 | ||||||||
| Lucy_069 | 274 | 266 | 270 ± 4 | K-Ar | k-feldspar | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor | LeBoutillier et al. (2003) | GSWE10_403 | |||||||||||
| Lucy_207 | 288 | 288 | 288 | Locality unknown. Previous age stated. | uraninite | Uraninite | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Miller et al (1964) | 10.1002/gj.3350040109 | GJ4_105 | Isotopic ages on the granites and associated rocks of South-West England, data of previous workers (in m.yrs) | ||||||||
| Lucy_232 | 228 | 218 | 223 ± 5 | 206 Pb/238U | Age of Uranite | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | |||||||||||
| Lucy_237 | 45 | 45 | 45 | 206 Pb/238U | Age of Pitchblende | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | Chemical Analysis only | ||||||||||
| Lucy_238 | 377 | 137 | 257 ± 120 | 207Pb/206Pb | Isotopic Age of Uranite | NCL1105 | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | (Ages taken from table with unclear titles) Chemical analysis of Pb. Analysis of 204Pb. | |||||||||
| Lucy_239 | 228 | 218 | 223 ± 5 | 206Pb/238U | Isotopic Age of Uranite | NCL1105 | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | (Ages taken from table with unclear titles) Chemical analysis of Pb. Analysis of 206Pb. | |||||||||
| Lucy_240 | 241 | 211 | 226 ± 15 | 207Pb/235U | Isotopic Age of Uranite | NCL1105 | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | (Ages taken from table with unclear titles) Chemical analysis of U. Analysis of 206Pb. | |||||||||
| Lucy_241 | 399 | 149 | 274 ± 125 | 208Pb/232U | Isotopic Age of Uranite | NCL1105 | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | (Ages taken from table with unclear titles) Chemical analysis of Th. Analysis of 208Pb. | |||||||||
| Lucy_256 | 297 | 283 | 290 ± 7 | 206Pb/238U | Using Pockleys Interpretations, it is acceptable to say that South Terras, Geevor, and Wheal Owles are not reliable indications of Tertiary mineralization. | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor | Darnley et al. (1965) | MM34_159 | |||||||||||
| Lucy_257 | 228 | 218 | 223 ± 5 | 206Pb/238U | Using Pockleys Interpretations, it is acceptable to say that South Terras, Geevor, and Wheal Owles are not reliable indications of Tertiary mineralization. | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor | Darnley et al. (1965) | MM34_159 | |||||||||||
| Lucy_258 | 45 | 45 | 45 | 206Pb/238U | Using Pockleys Interpretations, it is acceptable to say that South Terras, Geevor, and Wheal Owles are not reliable indications of Tertiary mineralization. | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor | Darnley et al. (1965) | MM34_159 | Chemical age. Late infilling. | ||||||||||
| Lucy_265 | 290 | 223 | The only firm conclusion about the uraninite mineralization at Geevor is that some of it must be older than 290 My. and some of it must be younger than 223 My. | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor | Darnley et al. (1965) | MM34_159 | The figure of 290 My. originally obtained from Geevor (Darnley et al., 1960), and the figure of 223 My. given here, may be mean ages of uraninite from different sections of the mine. However, from consideration of other results from the region it is likely that the figure of 290 My. is not far below the maximum age at which mineralization could have occurred. | ||||||||||||
| Lucy_274 | 220 | 220 | 220 | Galena age for Geevor Mine | galena | Galena | 1296 | Geevor Mine, Pendeen, St Just, Cornwall, England, UK | Geevor Mine | Darnley et al. (1965) | MM34_159 | These results have been calculated using Moorbath's constants, from the tables compiled by Pockley (1961) | |||||||||
| Lucy_062 | 283 | 275 | 279 ± 4 | Rb/Sr | Rb/Sr Age | 34473 | Lower Bostraze China Clay Pit, Tregeseal Valley, St Just, Cornwall, England, UK | Bostraze China Clay | Bray et al. (1983) | 10.2113/gsecongeo.78.6.1064 | EG78_1064 | ||||||||||
| Lucy_063 | 267 | 257 | 262 ± 5 | K/Ar | K/Ar Age | 34473 | Lower Bostraze China Clay Pit, Tregeseal Valley, St Just, Cornwall, England, UK | Bostraze China Clay | Bray et al. (1983) | 10.2113/gsecongeo.78.6.1064 | EG78_1064 | ||||||||||
| Lucy_136 | 267 | 257 | 262 ± 5 | K/Ar | Previous K/Ar determination | 34473 | Lower Bostraze China Clay Pit, Tregeseal Valley, St Just, Cornwall, England, UK | Bostraze China Clay | Bray and Spooner (1983) | 10.1144/GSL.SP.1964.001.01.15 | EG78_1064 | ||||||||||
| Lucy_137 | 283 | 275 | 279 ± 4 | Rb/Sr | Previous Rb/Sr determination | 34473 | Lower Bostraze China Clay Pit, Tregeseal Valley, St Just, Cornwall, England, UK | Bostraze China Clay | Bray and Spooner (1983) | 10.1144/GSL.SP.1964.001.01.15 | EG78_1064 |
| Sample | Source Locality | Reference URL |
|---|---|---|
| R070066 | Levant Mine, Trewellard, St Just, Cornwall, England, UK | https://rruff.info/R070066 |
| R060421 | Levant Mine, Trewellard, St Just, Cornwall, England, UK | https://rruff.info/R060421 |
All locality data graciously provided by mindat.org
All age data...
Other copyright data...